C24H27N5O2 — CID 42519609
(3R)-1-[(4-acetamidophenyl)methyl]-N-[4-(1H-pyrazol-5-yl)phenyl]piperidine-3-carboxamide (PubChem CID 42519609) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is (3R)-1-[(4-acetamidophenyl)methyl]-N-[4-(1H-pyrazol-5-yl)phenyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[(4-acetamidophenyl)methyl]-N-[4-(1H-pyrazol-5-yl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42519609 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | (3R)-1-[(4-acetamidophenyl)methyl]-N-[4-(1H-pyrazol-5-yl)phenyl]piperidine-3-carboxamide |
| SMILES | CC(=O)Nc1ccc(CN2CCC[C@@H](C(=O)Nc3ccc(-c4ccn[nH]4)cc3)C2)cc1 |
| InChI | InChI=1S/C24H27N5O2/c1-17(30)26-21-8-4-18(5-9-21)15-29-14-2-3-20(16-29)24(31)27-22-10-6-19(7-11-22)23-12-13-25-28-23/h4-13,20H,2-3,14-16H2,1H3,(H,25,28)(H,26,30)(H,27,31)/t20-/m1/s1 |
| InChIKey | OTAGIVVZHSLXFJ-HXUWFJFHSA-N |
| XLogP | 3.89 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |