C15H22N2O5 — CID 99943698
(2S)-N-[(3,4,5-trimethoxyphenyl)methyl]morpholine-2-carboxamide (PubChem CID 99943698) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is (2S)-N-[(3,4,5-trimethoxyphenyl)methyl]morpholine-2-carboxamide.
| Compound Name | (2S)-N-[(3,4,5-trimethoxyphenyl)methyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 99943698 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (2S)-N-[(3,4,5-trimethoxyphenyl)methyl]morpholine-2-carboxamide |
| SMILES | COc1cc(CNC(=O)[C@@H]2CNCCO2)cc(OC)c1OC |
| InChI | InChI=1S/C15H22N2O5/c1-19-11-6-10(7-12(20-2)14(11)21-3)8-17-15(18)13-9-16-4-5-22-13/h6-7,13,16H,4-5,8-9H2,1-3H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | KICMRSHMIASSTD-ZDUSSCGKSA-N |
| XLogP | 0.32 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |