C14H19BrN2O4 — CID 119764891
N-[(3-bromo-4,5-dimethoxyphenyl)methyl]morpholine-2-carboxamide (PubChem CID 119764891) has the molecular formula C14H19BrN2O4 and a molecular weight of 359.22 g/mol. Its IUPAC name is N-[(3-bromo-4,5-dimethoxyphenyl)methyl]morpholine-2-carboxamide.
| Compound Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119764891 |
| Molecular Formula | C14H19BrN2O4 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]morpholine-2-carboxamide |
| SMILES | COc1cc(CNC(=O)C2CNCCO2)cc(Br)c1OC |
| InChI | InChI=1S/C14H19BrN2O4/c1-19-11-6-9(5-10(15)13(11)20-2)7-17-14(18)12-8-16-3-4-21-12/h5-6,12,16H,3-4,7-8H2,1-2H3,(H,17,18) |
| InChIKey | TXLWERSTEROARP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |