C17H27ClN2O4 — CID 119786416
N-[3-(3-ethoxy-4-methoxyphenyl)propyl]morpholine-2-carboxamide;hydrochloride (PubChem CID 119786416) has the molecular formula C17H27ClN2O4 and a molecular weight of 358.87 g/mol. Its IUPAC name is N-[3-(3-ethoxy-4-methoxyphenyl)propyl]morpholine-2-carboxamide;hydrochloride.
| Compound Name | N-[3-(3-ethoxy-4-methoxyphenyl)propyl]morpholine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119786416 |
| Molecular Formula | C17H27ClN2O4 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[3-(3-ethoxy-4-methoxyphenyl)propyl]morpholine-2-carboxamide;hydrochloride |
| SMILES | CCOc1cc(CCCNC(=O)C2CNCCO2)ccc1OC.Cl |
| InChI | InChI=1S/C17H26N2O4.ClH/c1-3-22-15-11-13(6-7-14(15)21-2)5-4-8-19-17(20)16-12-18-9-10-23-16;/h6-7,11,16,18H,3-5,8-10,12H2,1-2H3,(H,19,20);1H |
| InChIKey | BCRZBEPKDSBAHJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|