C19H31ClN2O3 — CID 119786390
3-amino-N-[3-(3-ethoxy-4-methoxyphenyl)propyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119786390) has the molecular formula C19H31ClN2O3 and a molecular weight of 370.92 g/mol. Its IUPAC name is 3-amino-N-[3-(3-ethoxy-4-methoxyphenyl)propyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[3-(3-ethoxy-4-methoxyphenyl)propyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119786390 |
| Molecular Formula | C19H31ClN2O3 |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 3-amino-N-[3-(3-ethoxy-4-methoxyphenyl)propyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | CCOc1cc(CCCNC(=O)C2CCCC(N)C2)ccc1OC.Cl |
| InChI | InChI=1S/C19H30N2O3.ClH/c1-3-24-18-12-14(9-10-17(18)23-2)6-5-11-21-19(22)15-7-4-8-16(20)13-15;/h9-10,12,15-16H,3-8,11,13,20H2,1-2H3,(H,21,22);1H |
| InChIKey | VGIZTPACCWRQFN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|