C19H30N2O4 — CID 119786413
N-[3-(3-ethoxy-4-methoxyphenyl)propyl]-4-methoxypiperidine-4-carboxamide (PubChem CID 119786413) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is N-[3-(3-ethoxy-4-methoxyphenyl)propyl]-4-methoxypiperidine-4-carboxamide.
| Compound Name | N-[3-(3-ethoxy-4-methoxyphenyl)propyl]-4-methoxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 119786413 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | N-[3-(3-ethoxy-4-methoxyphenyl)propyl]-4-methoxypiperidine-4-carboxamide |
| SMILES | CCOc1cc(CCCNC(=O)C2(OC)CCNCC2)ccc1OC |
| InChI | InChI=1S/C19H30N2O4/c1-4-25-17-14-15(7-8-16(17)23-2)6-5-11-21-18(22)19(24-3)9-12-20-13-10-19/h7-8,14,20H,4-6,9-13H2,1-3H3,(H,21,22) |
| InChIKey | CBBRKJVNPCQDQB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|