C19H30N2O4 — CID 119677415
N-[2-(3,4-diethoxyphenyl)ethyl]-4-methoxypiperidine-4-carboxamide (PubChem CID 119677415) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-4-methoxypiperidine-4-carboxamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-methoxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 119677415 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-methoxypiperidine-4-carboxamide |
| SMILES | CCOc1ccc(CCNC(=O)C2(OC)CCNCC2)cc1OCC |
| InChI | InChI=1S/C19H30N2O4/c1-4-24-16-7-6-15(14-17(16)25-5-2)8-11-21-18(22)19(23-3)9-12-20-13-10-19/h6-7,14,20H,4-5,8-13H2,1-3H3,(H,21,22) |
| InChIKey | GTJQRSHXKXXCMW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |