C14H20N2O5 — CID 119808138
N-(2,4,5-trimethoxyphenyl)morpholine-2-carboxamide (PubChem CID 119808138) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is N-(2,4,5-trimethoxyphenyl)morpholine-2-carboxamide.
| Compound Name | N-(2,4,5-trimethoxyphenyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119808138 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-(2,4,5-trimethoxyphenyl)morpholine-2-carboxamide |
| SMILES | COc1cc(OC)c(OC)cc1NC(=O)C1CNCCO1 |
| InChI | InChI=1S/C14H20N2O5/c1-18-10-7-12(20-3)11(19-2)6-9(10)16-14(17)13-8-15-4-5-21-13/h6-7,13,15H,4-5,8H2,1-3H3,(H,16,17) |
| InChIKey | HHDGTAFSKRFZCP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |