C13H16N4O4 — CID 86984728
5-(furan-2-yl)-N-[2-(2-methoxyethylamino)-2-oxoethyl]-1H-pyrazole-3-carboxamide (PubChem CID 86984728) has the molecular formula C13H16N4O4 and a molecular weight of 292.29 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-[2-(2-methoxyethylamino)-2-oxoethyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-[2-(2-methoxyethylamino)-2-oxoethyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 86984728 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 5-(furan-2-yl)-N-[2-(2-methoxyethylamino)-2-oxoethyl]-1H-pyrazole-3-carboxamide |
| SMILES | COCCNC(=O)CNC(=O)c1cc(-c2ccco2)[nH]n1 |
| InChI | InChI=1S/C13H16N4O4/c1-20-6-4-14-12(18)8-15-13(19)10-7-9(16-17-10)11-3-2-5-21-11/h2-3,5,7H,4,6,8H2,1H3,(H,14,18)(H,15,19)(H,16,17) |
| InChIKey | AMEFPUBUNAAPKG-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|