C17H17N3O4 — CID 111115498
5-(furan-2-yl)-N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-1H-pyrazole-3-carboxamide (PubChem CID 111115498) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 111115498 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 5-(furan-2-yl)-N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-1H-pyrazole-3-carboxamide |
| SMILES | COc1cccc(C(O)CNC(=O)c2cc(-c3ccco3)[nH]n2)c1 |
| InChI | InChI=1S/C17H17N3O4/c1-23-12-5-2-4-11(8-12)15(21)10-18-17(22)14-9-13(19-20-14)16-6-3-7-24-16/h2-9,15,21H,10H2,1H3,(H,18,22)(H,19,20) |
| InChIKey | XGUMWVZUOYOVGL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |