C18H19N3O4 — CID 86841396
5-(furan-2-yl)-N-[2-hydroxy-3-(3-methylphenoxy)propyl]-1H-pyrazole-3-carboxamide (PubChem CID 86841396) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-[2-hydroxy-3-(3-methylphenoxy)propyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-[2-hydroxy-3-(3-methylphenoxy)propyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 86841396 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 5-(furan-2-yl)-N-[2-hydroxy-3-(3-methylphenoxy)propyl]-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cccc(OCC(O)CNC(=O)c2cc(-c3ccco3)[nH]n2)c1 |
| InChI | InChI=1S/C18H19N3O4/c1-12-4-2-5-14(8-12)25-11-13(22)10-19-18(23)16-9-15(20-21-16)17-6-3-7-24-17/h2-9,13,22H,10-11H2,1H3,(H,19,23)(H,20,21) |
| InChIKey | RFCXEQXGTAVFHJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |