C21H15N3O4 — CID 90579599
5-(furan-2-yl)-N-(4-quinolin-8-yloxybut-2-ynyl)-1,2-oxazole-3-carboxamide (PubChem CID 90579599) has the molecular formula C21H15N3O4 and a molecular weight of 373.37 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-(4-quinolin-8-yloxybut-2-ynyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-(4-quinolin-8-yloxybut-2-ynyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 90579599 |
| Molecular Formula | C21H15N3O4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 5-(furan-2-yl)-N-(4-quinolin-8-yloxybut-2-ynyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCC#CCOc1cccc2cccnc12)c1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C21H15N3O4/c25-21(16-14-19(28-24-16)17-9-5-13-26-17)23-10-1-2-12-27-18-8-3-6-15-7-4-11-22-20(15)18/h3-9,11,13-14H,10,12H2,(H,23,25) |
| InChIKey | AKZIFYFXUQLZRH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|