C22H14F6N2O2 — CID 90579722
N-(4-quinolin-8-yloxybut-2-ynyl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 90579722) has the molecular formula C22H14F6N2O2 and a molecular weight of 452.35 g/mol. Its IUPAC name is N-(4-quinolin-8-yloxybut-2-ynyl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(4-quinolin-8-yloxybut-2-ynyl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 90579722 |
| Molecular Formula | C22H14F6N2O2 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | N-(4-quinolin-8-yloxybut-2-ynyl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(NCC#CCOc1cccc2cccnc12)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H14F6N2O2/c23-21(24,25)16-11-15(12-17(13-16)22(26,27)28)20(31)30-8-1-2-10-32-18-7-3-5-14-6-4-9-29-19(14)18/h3-7,9,11-13H,8,10H2,(H,30,31) |
| InChIKey | NOCUMFGIGAYWGL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|