C21H16F3N3O2 — CID 90579896
1-(4-quinolin-8-yloxybut-2-ynyl)-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 90579896) has the molecular formula C21H16F3N3O2 and a molecular weight of 399.37 g/mol. Its IUPAC name is 1-(4-quinolin-8-yloxybut-2-ynyl)-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(4-quinolin-8-yloxybut-2-ynyl)-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 90579896 |
| Molecular Formula | C21H16F3N3O2 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 1-(4-quinolin-8-yloxybut-2-ynyl)-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCC#CCOc1cccc2cccnc12)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H16F3N3O2/c22-21(23,24)16-9-1-2-10-17(16)27-20(28)26-12-3-4-14-29-18-11-5-7-15-8-6-13-25-19(15)18/h1-2,5-11,13H,12,14H2,(H2,26,27,28) |
| InChIKey | CSOKXPZENSHIJT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|