C17H12F3N3O2 — CID 67279636
1-(8-hydroxyquinolin-7-yl)-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 67279636) has the molecular formula C17H12F3N3O2 and a molecular weight of 347.30 g/mol. Its IUPAC name is 1-(8-hydroxyquinolin-7-yl)-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(8-hydroxyquinolin-7-yl)-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 67279636 |
| Molecular Formula | C17H12F3N3O2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-(8-hydroxyquinolin-7-yl)-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)Nc1ccc2cccnc2c1O |
| InChI | InChI=1S/C17H12F3N3O2/c18-17(19,20)11-5-1-2-6-12(11)22-16(25)23-13-8-7-10-4-3-9-21-14(10)15(13)24/h1-9,24H,(H2,22,23,25) |
| InChIKey | UDGBLHSTBCRXJB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|