C23H22N2O5 — CID 90579692
3,4,5-trimethoxy-N-(4-quinolin-8-yloxybut-2-ynyl)benzamide (PubChem CID 90579692) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(4-quinolin-8-yloxybut-2-ynyl)benzamide.
| Compound Name | 3,4,5-trimethoxy-N-(4-quinolin-8-yloxybut-2-ynyl)benzamide |
|---|---|
| PubChem CID | 90579692 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 3,4,5-trimethoxy-N-(4-quinolin-8-yloxybut-2-ynyl)benzamide |
| SMILES | COc1cc(C(=O)NCC#CCOc2cccc3cccnc23)cc(OC)c1OC |
| InChI | InChI=1S/C23H22N2O5/c1-27-19-14-17(15-20(28-2)22(19)29-3)23(26)25-11-4-5-13-30-18-10-6-8-16-9-7-12-24-21(16)18/h6-10,12,14-15H,11,13H2,1-3H3,(H,25,26) |
| InChIKey | HJUZXTUAGGZDBT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|