C19H14F6N2O2 — CID 90579313
N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 90579313) has the molecular formula C19H14F6N2O2 and a molecular weight of 416.32 g/mol. Its IUPAC name is N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 90579313 |
| Molecular Formula | C19H14F6N2O2 |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(OCC#CCNC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C19H14F6N2O2/c1-12-4-5-16(11-27-12)29-7-3-2-6-26-17(28)13-8-14(18(20,21)22)10-15(9-13)19(23,24)25/h4-5,8-11H,6-7H2,1H3,(H,26,28) |
| InChIKey | WGUSNARRGJFEAT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|