C17H17N3O3S — CID 42566769
N-(2-methylsulfanylethyl)-5-(quinolin-8-yloxymethyl)-1,2-oxazole-3-carboxamide (PubChem CID 42566769) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-(2-methylsulfanylethyl)-5-(quinolin-8-yloxymethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2-methylsulfanylethyl)-5-(quinolin-8-yloxymethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 42566769 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-(2-methylsulfanylethyl)-5-(quinolin-8-yloxymethyl)-1,2-oxazole-3-carboxamide |
| SMILES | CSCCNC(=O)c1cc(COc2cccc3cccnc23)on1 |
| InChI | InChI=1S/C17H17N3O3S/c1-24-9-8-19-17(21)14-10-13(23-20-14)11-22-15-6-2-4-12-5-3-7-18-16(12)15/h2-7,10H,8-9,11H2,1H3,(H,19,21) |
| InChIKey | KKDGNNSUOBFQIL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|