C23H21NO4 — CID 90578119
2-(3-methoxyphenoxy)-N-(4-naphthalen-1-yloxybut-2-ynyl)acetamide (PubChem CID 90578119) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is 2-(3-methoxyphenoxy)-N-(4-naphthalen-1-yloxybut-2-ynyl)acetamide.
| Compound Name | 2-(3-methoxyphenoxy)-N-(4-naphthalen-1-yloxybut-2-ynyl)acetamide |
|---|---|
| PubChem CID | 90578119 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 2-(3-methoxyphenoxy)-N-(4-naphthalen-1-yloxybut-2-ynyl)acetamide |
| SMILES | COc1cccc(OCC(=O)NCC#CCOc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C23H21NO4/c1-26-19-10-7-11-20(16-19)28-17-23(25)24-14-4-5-15-27-22-13-6-9-18-8-2-3-12-21(18)22/h2-3,6-13,16H,14-15,17H2,1H3,(H,24,25) |
| InChIKey | DRWSRCHOBWYQDN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|