C22H17Cl2NO3 — CID 90578114
2-(2,4-dichlorophenoxy)-N-(4-naphthalen-1-yloxybut-2-ynyl)acetamide (PubChem CID 90578114) has the molecular formula C22H17Cl2NO3 and a molecular weight of 414.29 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(4-naphthalen-1-yloxybut-2-ynyl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(4-naphthalen-1-yloxybut-2-ynyl)acetamide |
|---|---|
| PubChem CID | 90578114 |
| Molecular Formula | C22H17Cl2NO3 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(4-naphthalen-1-yloxybut-2-ynyl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NCC#CCOc1cccc2ccccc12 |
| InChI | InChI=1S/C22H17Cl2NO3/c23-17-10-11-21(19(24)14-17)28-15-22(26)25-12-3-4-13-27-20-9-5-7-16-6-1-2-8-18(16)20/h1-2,5-11,14H,12-13,15H2,(H,25,26) |
| InChIKey | BKNVGHOHTGSHDI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|