C18H17N3O4 — CID 90580567
N-[4-(2-carbamoylphenoxy)but-2-ynyl]-5-cyclopropyl-1,2-oxazole-3-carboxamide (PubChem CID 90580567) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is N-[4-(2-carbamoylphenoxy)but-2-ynyl]-5-cyclopropyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[4-(2-carbamoylphenoxy)but-2-ynyl]-5-cyclopropyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 90580567 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-[4-(2-carbamoylphenoxy)but-2-ynyl]-5-cyclopropyl-1,2-oxazole-3-carboxamide |
| SMILES | NC(=O)c1ccccc1OCC#CCNC(=O)c1cc(C2CC2)on1 |
| InChI | InChI=1S/C18H17N3O4/c19-17(22)13-5-1-2-6-15(13)24-10-4-3-9-20-18(23)14-11-16(25-21-14)12-7-8-12/h1-2,5-6,11-12H,7-10H2,(H2,19,22)(H,20,23) |
| InChIKey | CWHQOSWZYBTOES-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|