C15H16N2O5 — CID 90580446
ethyl 2-[4-(2-carbamoylphenoxy)but-2-ynylamino]-2-oxoacetate (PubChem CID 90580446) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is ethyl 2-[4-(2-carbamoylphenoxy)but-2-ynylamino]-2-oxoacetate.
| Compound Name | ethyl 2-[4-(2-carbamoylphenoxy)but-2-ynylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 90580446 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | ethyl 2-[4-(2-carbamoylphenoxy)but-2-ynylamino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NCC#CCOc1ccccc1C(N)=O |
| InChI | InChI=1S/C15H16N2O5/c1-2-21-15(20)14(19)17-9-5-6-10-22-12-8-4-3-7-11(12)13(16)18/h3-4,7-8H,2,9-10H2,1H3,(H2,16,18)(H,17,19) |
| InChIKey | JQEYHFIZBLVNGM-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|