C22H18N2O6 — CID 90580558
N-[4-(2-carbamoylphenoxy)but-2-ynyl]-8-methoxy-2-oxochromene-3-carboxamide (PubChem CID 90580558) has the molecular formula C22H18N2O6 and a molecular weight of 406.39 g/mol. Its IUPAC name is N-[4-(2-carbamoylphenoxy)but-2-ynyl]-8-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-[4-(2-carbamoylphenoxy)but-2-ynyl]-8-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 90580558 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-[4-(2-carbamoylphenoxy)but-2-ynyl]-8-methoxy-2-oxochromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)NCC#CCOc3ccccc3C(N)=O)c(=O)oc12 |
| InChI | InChI=1S/C22H18N2O6/c1-28-18-10-6-7-14-13-16(22(27)30-19(14)18)21(26)24-11-4-5-12-29-17-9-3-2-8-15(17)20(23)25/h2-3,6-10,13H,11-12H2,1H3,(H2,23,25)(H,24,26) |
| InChIKey | HIYOQSSIGKLBFE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|