C22H18BrNO2 — CID 90576529
N-[4-(3-bromophenoxy)but-2-ynyl]-2-naphthalen-1-ylacetamide (PubChem CID 90576529) has the molecular formula C22H18BrNO2 and a molecular weight of 408.30 g/mol. Its IUPAC name is N-[4-(3-bromophenoxy)but-2-ynyl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[4-(3-bromophenoxy)but-2-ynyl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 90576529 |
| Molecular Formula | C22H18BrNO2 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | N-[4-(3-bromophenoxy)but-2-ynyl]-2-naphthalen-1-ylacetamide |
| SMILES | O=C(Cc1cccc2ccccc12)NCC#CCOc1cccc(Br)c1 |
| InChI | InChI=1S/C22H18BrNO2/c23-19-10-6-11-20(16-19)26-14-4-3-13-24-22(25)15-18-9-5-8-17-7-1-2-12-21(17)18/h1-2,5-12,16H,13-15H2,(H,24,25) |
| InChIKey | XWXDQZUNAQMPEV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|