C23H18F3NO2 — CID 90575902
2-naphthalen-1-yl-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]acetamide (PubChem CID 90575902) has the molecular formula C23H18F3NO2 and a molecular weight of 397.40 g/mol. Its IUPAC name is 2-naphthalen-1-yl-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]acetamide.
| Compound Name | 2-naphthalen-1-yl-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]acetamide |
|---|---|
| PubChem CID | 90575902 |
| Molecular Formula | C23H18F3NO2 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-naphthalen-1-yl-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]acetamide |
| SMILES | O=C(Cc1cccc2ccccc12)NCC#CCOc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H18F3NO2/c24-23(25,26)19-10-6-11-20(16-19)29-14-4-3-13-27-22(28)15-18-9-5-8-17-7-1-2-12-21(17)18/h1-2,5-12,16H,13-15H2,(H,27,28) |
| InChIKey | DDVBWDAMXPZWHZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|