C20H15F3N4O2 — CID 90575768
2-phenyl-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]triazole-4-carboxamide (PubChem CID 90575768) has the molecular formula C20H15F3N4O2 and a molecular weight of 400.36 g/mol. Its IUPAC name is 2-phenyl-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]triazole-4-carboxamide.
| Compound Name | 2-phenyl-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 90575768 |
| Molecular Formula | C20H15F3N4O2 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-phenyl-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]triazole-4-carboxamide |
| SMILES | O=C(NCC#CCOc1cccc(C(F)(F)F)c1)c1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H15F3N4O2/c21-20(22,23)15-7-6-10-17(13-15)29-12-5-4-11-24-19(28)18-14-25-27(26-18)16-8-2-1-3-9-16/h1-3,6-10,13-14H,11-12H2,(H,24,28) |
| InChIKey | CTXJWXGIZBJZIG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|