C18H14F4N2O2 — CID 90576010
1-(2-fluorophenyl)-3-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]urea (PubChem CID 90576010) has the molecular formula C18H14F4N2O2 and a molecular weight of 366.31 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]urea |
|---|---|
| PubChem CID | 90576010 |
| Molecular Formula | C18H14F4N2O2 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]urea |
| SMILES | O=C(NCC#CCOc1cccc(C(F)(F)F)c1)Nc1ccccc1F |
| InChI | InChI=1S/C18H14F4N2O2/c19-15-8-1-2-9-16(15)24-17(25)23-10-3-4-11-26-14-7-5-6-13(12-14)18(20,21)22/h1-2,5-9,12H,10-11H2,(H2,23,24,25) |
| InChIKey | JYXSJNHHGXUIMP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|