C23H21ClF3NO2 — CID 121131559
1-(4-chlorophenyl)-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]cyclopentane-1-carboxamide (PubChem CID 121131559) has the molecular formula C23H21ClF3NO2 and a molecular weight of 435.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]cyclopentane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 121131559 |
| Molecular Formula | C23H21ClF3NO2 |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]cyclopentane-1-carboxamide |
| SMILES | O=C(NCC#CCOc1cccc(C(F)(F)F)c1)C1(c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C23H21ClF3NO2/c24-19-10-8-17(9-11-19)22(12-1-2-13-22)21(29)28-14-3-4-15-30-20-7-5-6-18(16-20)23(25,26)27/h5-11,16H,1-2,12-15H2,(H,28,29) |
| InChIKey | OHEXMFIHLTVELF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|