C18H16BrFN2O2 — CID 90576667
1-[4-(3-bromophenoxy)but-2-ynyl]-3-[(4-fluorophenyl)methyl]urea (PubChem CID 90576667) has the molecular formula C18H16BrFN2O2 and a molecular weight of 391.24 g/mol. Its IUPAC name is 1-[4-(3-bromophenoxy)but-2-ynyl]-3-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-[4-(3-bromophenoxy)but-2-ynyl]-3-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 90576667 |
| Molecular Formula | C18H16BrFN2O2 |
| Molecular Weight | 391.24 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 1-[4-(3-bromophenoxy)but-2-ynyl]-3-[(4-fluorophenyl)methyl]urea |
| SMILES | O=C(NCC#CCOc1cccc(Br)c1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H16BrFN2O2/c19-15-4-3-5-17(12-15)24-11-2-1-10-21-18(23)22-13-14-6-8-16(20)9-7-14/h3-9,12H,10-11,13H2,(H2,21,22,23) |
| InChIKey | NBWFOENDWOEDIR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|