C17H12BrF2NO2 — CID 90576565
N-[4-(3-bromophenoxy)but-2-ynyl]-2,4-difluorobenzamide (PubChem CID 90576565) has the molecular formula C17H12BrF2NO2 and a molecular weight of 380.19 g/mol. Its IUPAC name is N-[4-(3-bromophenoxy)but-2-ynyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-(3-bromophenoxy)but-2-ynyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 90576565 |
| Molecular Formula | C17H12BrF2NO2 |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | N-[4-(3-bromophenoxy)but-2-ynyl]-2,4-difluorobenzamide |
| SMILES | O=C(NCC#CCOc1cccc(Br)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H12BrF2NO2/c18-12-4-3-5-14(10-12)23-9-2-1-8-21-17(22)15-7-6-13(19)11-16(15)20/h3-7,10-11H,8-9H2,(H,21,22) |
| InChIKey | UEEYKBDTEKPQCN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|