C22H23BrN2O4S — CID 90576537
N-[4-(3-bromophenoxy)but-2-ynyl]-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 90576537) has the molecular formula C22H23BrN2O4S and a molecular weight of 491.41 g/mol. Its IUPAC name is N-[4-(3-bromophenoxy)but-2-ynyl]-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[4-(3-bromophenoxy)but-2-ynyl]-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 90576537 |
| Molecular Formula | C22H23BrN2O4S |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | N-[4-(3-bromophenoxy)but-2-ynyl]-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCC#CCOc1cccc(Br)c1)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H23BrN2O4S/c23-19-7-6-8-20(17-19)29-16-5-2-13-24-22(26)18-9-11-21(12-10-18)30(27,28)25-14-3-1-4-15-25/h6-12,17H,1,3-4,13-16H2,(H,24,26) |
| InChIKey | QTWMSPMZNQZILV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|