C19H13F2N3O — CID 90547769
3-(4-fluorophenyl)-N-[3-(2-fluorophenyl)prop-2-ynyl]-1H-pyrazole-5-carboxamide (PubChem CID 90547769) has the molecular formula C19H13F2N3O and a molecular weight of 337.33 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[3-(2-fluorophenyl)prop-2-ynyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-[3-(2-fluorophenyl)prop-2-ynyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90547769 |
| Molecular Formula | C19H13F2N3O |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[3-(2-fluorophenyl)prop-2-ynyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCC#Cc1ccccc1F)c1cc(-c2ccc(F)cc2)n[nH]1 |
| InChI | InChI=1S/C19H13F2N3O/c20-15-9-7-14(8-10-15)17-12-18(24-23-17)19(25)22-11-3-5-13-4-1-2-6-16(13)21/h1-2,4,6-10,12H,11H2,(H,22,25)(H,23,24) |
| InChIKey | SLFOLKVPOMJOSI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|