C17H14F2N2O — CID 90552596
1-[(4-fluorophenyl)methyl]-3-[3-(2-fluorophenyl)prop-2-ynyl]urea (PubChem CID 90552596) has the molecular formula C17H14F2N2O and a molecular weight of 300.31 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[3-(2-fluorophenyl)prop-2-ynyl]urea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[3-(2-fluorophenyl)prop-2-ynyl]urea |
|---|---|
| PubChem CID | 90552596 |
| Molecular Formula | C17H14F2N2O |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[3-(2-fluorophenyl)prop-2-ynyl]urea |
| SMILES | O=C(NCC#Cc1ccccc1F)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H14F2N2O/c18-15-9-7-13(8-10-15)12-21-17(22)20-11-3-5-14-4-1-2-6-16(14)19/h1-2,4,6-10H,11-12H2,(H2,20,21,22) |
| InChIKey | OWCCIIMKYUEUCT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|