C17H15FN2O — CID 90552583
1-benzyl-3-[3-(2-fluorophenyl)prop-2-ynyl]urea (PubChem CID 90552583) has the molecular formula C17H15FN2O and a molecular weight of 282.32 g/mol. Its IUPAC name is 1-benzyl-3-[3-(2-fluorophenyl)prop-2-ynyl]urea.
| Compound Name | 1-benzyl-3-[3-(2-fluorophenyl)prop-2-ynyl]urea |
|---|---|
| PubChem CID | 90552583 |
| Molecular Formula | C17H15FN2O |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-benzyl-3-[3-(2-fluorophenyl)prop-2-ynyl]urea |
| SMILES | O=C(NCC#Cc1ccccc1F)NCc1ccccc1 |
| InChI | InChI=1S/C17H15FN2O/c18-16-11-5-4-9-15(16)10-6-12-19-17(21)20-13-14-7-2-1-3-8-14/h1-5,7-9,11H,12-13H2,(H2,19,20,21) |
| InChIKey | VCXGHWCXXHKVLZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|