C16H11F3N2O — CID 90552580
1-(2,6-difluorophenyl)-3-[3-(2-fluorophenyl)prop-2-ynyl]urea (PubChem CID 90552580) has the molecular formula C16H11F3N2O and a molecular weight of 304.27 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[3-(2-fluorophenyl)prop-2-ynyl]urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[3-(2-fluorophenyl)prop-2-ynyl]urea |
|---|---|
| PubChem CID | 90552580 |
| Molecular Formula | C16H11F3N2O |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[3-(2-fluorophenyl)prop-2-ynyl]urea |
| SMILES | O=C(NCC#Cc1ccccc1F)Nc1c(F)cccc1F |
| InChI | InChI=1S/C16H11F3N2O/c17-12-7-2-1-5-11(12)6-4-10-20-16(22)21-15-13(18)8-3-9-14(15)19/h1-3,5,7-9H,10H2,(H2,20,21,22) |
| InChIKey | DIIYEXLORYHVIF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|