C12H12FNO2 — CID 90547821
N-[3-(2-fluorophenyl)prop-2-ynyl]-2-methoxyacetamide (PubChem CID 90547821) has the molecular formula C12H12FNO2 and a molecular weight of 221.23 g/mol. Its IUPAC name is N-[3-(2-fluorophenyl)prop-2-ynyl]-2-methoxyacetamide.
| Compound Name | N-[3-(2-fluorophenyl)prop-2-ynyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 90547821 |
| Molecular Formula | C12H12FNO2 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | N-[3-(2-fluorophenyl)prop-2-ynyl]-2-methoxyacetamide |
| SMILES | COCC(=O)NCC#Cc1ccccc1F |
| InChI | InChI=1S/C12H12FNO2/c1-16-9-12(15)14-8-4-6-10-5-2-3-7-11(10)13/h2-3,5,7H,8-9H2,1H3,(H,14,15) |
| InChIKey | PGCJNGGOMDXTAB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|