C17H14FNOS — CID 90547949
N-[3-(2-fluorophenyl)prop-2-ynyl]-2-methylsulfanylbenzamide (PubChem CID 90547949) has the molecular formula C17H14FNOS and a molecular weight of 299.37 g/mol. Its IUPAC name is N-[3-(2-fluorophenyl)prop-2-ynyl]-2-methylsulfanylbenzamide.
| Compound Name | N-[3-(2-fluorophenyl)prop-2-ynyl]-2-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 90547949 |
| Molecular Formula | C17H14FNOS |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-[3-(2-fluorophenyl)prop-2-ynyl]-2-methylsulfanylbenzamide |
| SMILES | CSc1ccccc1C(=O)NCC#Cc1ccccc1F |
| InChI | InChI=1S/C17H14FNOS/c1-21-16-11-5-3-9-14(16)17(20)19-12-6-8-13-7-2-4-10-15(13)18/h2-5,7,9-11H,12H2,1H3,(H,19,20) |
| InChIKey | AZKNESZSDFWJSX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|