C17H13F2N3O — CID 121084055
N-[(2,4-difluorophenyl)methyl]-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 121084055) has the molecular formula C17H13F2N3O and a molecular weight of 313.31 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 121084055 |
| Molecular Formula | C17H13F2N3O |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1F)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C17H13F2N3O/c18-13-7-6-12(14(19)8-13)10-20-17(23)16-9-15(21-22-16)11-4-2-1-3-5-11/h1-9H,10H2,(H,20,23)(H,21,22) |
| InChIKey | YIMCUXQZOVIQEL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |