C21H18N4 — CID 171366783
N'-(3-cyano-4,6-diphenyl-2-pyridinyl)-N,N-dimethylmethanimidamide (PubChem CID 171366783) has the molecular formula C21H18N4 and a molecular weight of 326.40 g/mol. Its IUPAC name is N'-(3-cyano-4,6-diphenyl-2-pyridinyl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(3-cyano-4,6-diphenyl-2-pyridinyl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 171366783 |
| Molecular Formula | C21H18N4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N'-(3-cyano-4,6-diphenyl-2-pyridinyl)-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1nc(-c2ccccc2)cc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C21H18N4/c1-25(2)15-23-21-19(14-22)18(16-9-5-3-6-10-16)13-20(24-21)17-11-7-4-8-12-17/h3-13,15H,1-2H3/b23-15+ |
| InChIKey | JCBCRPLTNBQANR-HZHRSRAPSA-N |
| XLogP | 4.51 |
| TPSA | 52.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|