C22H19BrN4 — CID 171367060
N'-[4-(4-bromophenyl)-3-cyano-6-(4-methylphenyl)-2-pyridinyl]-N,N-dimethylmethanimidamide (PubChem CID 171367060) has the molecular formula C22H19BrN4 and a molecular weight of 419.33 g/mol. Its IUPAC name is N'-[4-(4-bromophenyl)-3-cyano-6-(4-methylphenyl)-2-pyridinyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-(4-bromophenyl)-3-cyano-6-(4-methylphenyl)-2-pyridinyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 171367060 |
| Molecular Formula | C22H19BrN4 |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | N'-[4-(4-bromophenyl)-3-cyano-6-(4-methylphenyl)-2-pyridinyl]-N,N-dimethylmethanimidamide |
| SMILES | Cc1ccc(-c2cc(-c3ccc(Br)cc3)c(C#N)c(/N=C/N(C)C)n2)cc1 |
| InChI | InChI=1S/C22H19BrN4/c1-15-4-6-17(7-5-15)21-12-19(16-8-10-18(23)11-9-16)20(13-24)22(26-21)25-14-27(2)3/h4-12,14H,1-3H3/b25-14+ |
| InChIKey | JGNUIRTZGGAMMY-AFUMVMLFSA-N |
| XLogP | 5.58 |
| TPSA | 52.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|