C17H15N5O — CID 12736670
N'-(3,5-dicyano-4-methyl-6-phenoxy-2-pyridinyl)-N,N-dimethylmethanimidamide (PubChem CID 12736670) has the molecular formula C17H15N5O and a molecular weight of 305.34 g/mol. Its IUPAC name is N'-(3,5-dicyano-4-methyl-6-phenoxy-2-pyridinyl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(3,5-dicyano-4-methyl-6-phenoxy-2-pyridinyl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 12736670 |
| Molecular Formula | C17H15N5O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N'-(3,5-dicyano-4-methyl-6-phenoxy-2-pyridinyl)-N,N-dimethylmethanimidamide |
| SMILES | Cc1c(C#N)c(/N=C/N(C)C)nc(Oc2ccccc2)c1C#N |
| InChI | InChI=1S/C17H15N5O/c1-12-14(9-18)16(20-11-22(2)3)21-17(15(12)10-19)23-13-7-5-4-6-8-13/h4-8,11H,1-3H3/b20-11+ |
| InChIKey | AMWAADCLRVFXNT-RGVLZGJSSA-N |
| XLogP | 3.15 |
| TPSA | 85.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|