C15H14N4O — CID 117061761
N'-[4-cyano-2-[(E)-2-phenylethenyl]-1,3-oxazol-5-yl]-N,N-dimethylmethanimidamide (PubChem CID 117061761) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is N'-[4-cyano-2-[(E)-2-phenylethenyl]-1,3-oxazol-5-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-cyano-2-[(E)-2-phenylethenyl]-1,3-oxazol-5-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 117061761 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | N'-[4-cyano-2-[(E)-2-phenylethenyl]-1,3-oxazol-5-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1oc(/C=C/c2ccccc2)nc1C#N |
| InChI | InChI=1S/C15H14N4O/c1-19(2)11-17-15-13(10-16)18-14(20-15)9-8-12-6-4-3-5-7-12/h3-9,11H,1-2H3/b9-8+,17-11+ |
| InChIKey | RUWMYHLZEYVUJB-WRFVMNGSSA-N |
| XLogP | 2.94 |
| TPSA | 65.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|