C31H29IN2OP+ — CID 126957819
[5-(dimethylamino)-2-[(E)-2-phenylethenyl]-1,3-oxazol-4-yl]-triphenylphosphanium;hydroiodide (PubChem CID 126957819) has the molecular formula C31H29IN2OP+ and a molecular weight of 603.46 g/mol. Its IUPAC name is [5-(dimethylamino)-2-[(E)-2-phenylethenyl]-1,3-oxazol-4-yl]-triphenylphosphanium;hydroiodide.
| Compound Name | [5-(dimethylamino)-2-[(E)-2-phenylethenyl]-1,3-oxazol-4-yl]-triphenylphosphanium;hydroiodide |
|---|---|
| PubChem CID | 126957819 |
| Molecular Formula | C31H29IN2OP+ |
| Molecular Weight | 603.46 g/mol |
| Exact Mass | 603.11 |
| IUPAC Name | [5-(dimethylamino)-2-[(E)-2-phenylethenyl]-1,3-oxazol-4-yl]-triphenylphosphanium;hydroiodide |
| SMILES | CN(C)c1oc(/C=C/c2ccccc2)nc1[P+](c1ccccc1)(c1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C31H28N2OP.HI/c1-33(2)31-30(32-29(34-31)24-23-25-15-7-3-8-16-25)35(26-17-9-4-10-18-26,27-19-11-5-12-20-27)28-21-13-6-14-22-28;/h3-24H,1-2H3;1H/q+1;/b24-23+; |
| InChIKey | QIWVTWVTGBZBGB-XMXXDQCKSA-N |
| XLogP | 6.15 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.46 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|