C16H17N5Si — CID 169398364
2,4-diamino-6-[3-(2-trimethylsilylethynyl)phenyl]pyrimidine-5-carbonitrile (PubChem CID 169398364) has the molecular formula C16H17N5Si and a molecular weight of 307.43 g/mol. Its IUPAC name is 2,4-diamino-6-[3-(2-trimethylsilylethynyl)phenyl]pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-[3-(2-trimethylsilylethynyl)phenyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169398364 |
| Molecular Formula | C16H17N5Si |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2,4-diamino-6-[3-(2-trimethylsilylethynyl)phenyl]pyrimidine-5-carbonitrile |
| SMILES | C[Si](C)(C)C#Cc1cccc(-c2nc(N)nc(N)c2C#N)c1 |
| InChI | InChI=1S/C16H17N5Si/c1-22(2,3)8-7-11-5-4-6-12(9-11)14-13(10-17)15(18)21-16(19)20-14/h4-6,9H,1-3H3,(H4,18,19,20,21) |
| InChIKey | YCJUNFJPLUFJQH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 101.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|