C14H9F4N3OS — CID 168589063
4-[4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168589063) has the molecular formula C14H9F4N3OS and a molecular weight of 343.31 g/mol. Its IUPAC name is 4-[4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-[4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168589063 |
| Molecular Formula | C14H9F4N3OS |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 4-[4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2ccc(F)c(C)c2C(F)(F)F)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C14H9F4N3OS/c1-6-9(15)4-3-7(10(6)14(16,17)18)11-8(5-19)12(22)21-13(20-11)23-2/h3-4H,1-2H3,(H,20,21,22) |
| InChIKey | IFJSHVFMILRHBU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|