C15H9FN4OS — CID 168589780
4-(5-fluoroquinolin-8-yl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168589780) has the molecular formula C15H9FN4OS and a molecular weight of 312.33 g/mol. Its IUPAC name is 4-(5-fluoroquinolin-8-yl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(5-fluoroquinolin-8-yl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168589780 |
| Molecular Formula | C15H9FN4OS |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 4-(5-fluoroquinolin-8-yl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2ccc(F)c3cccnc23)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C15H9FN4OS/c1-22-15-19-13(10(7-17)14(21)20-15)9-4-5-11(16)8-3-2-6-18-12(8)9/h2-6H,1H3,(H,19,20,21) |
| InChIKey | BAYZFACQWQCOHX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|