C13H7F3IN3OS — CID 168588526
4-[2-iodo-5-(trifluoromethyl)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168588526) has the molecular formula C13H7F3IN3OS and a molecular weight of 437.18 g/mol. Its IUPAC name is 4-[2-iodo-5-(trifluoromethyl)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-[2-iodo-5-(trifluoromethyl)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168588526 |
| Molecular Formula | C13H7F3IN3OS |
| Molecular Weight | 437.18 g/mol |
| Exact Mass | 436.93 |
| IUPAC Name | 4-[2-iodo-5-(trifluoromethyl)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2cc(C(F)(F)F)ccc2I)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C13H7F3IN3OS/c1-22-12-19-10(8(5-18)11(21)20-12)7-4-6(13(14,15)16)2-3-9(7)17/h2-4H,1H3,(H,19,20,21) |
| InChIKey | HUZDKVADBKNLNU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.18 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|