C19H12FN3O3S — CID 168590135
4-[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenyl]-3-fluorobenzoic acid (PubChem CID 168590135) has the molecular formula C19H12FN3O3S and a molecular weight of 381.39 g/mol. Its IUPAC name is 4-[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenyl]-3-fluorobenzoic acid.
| Compound Name | 4-[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 168590135 |
| Molecular Formula | C19H12FN3O3S |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 4-[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenyl]-3-fluorobenzoic acid |
| SMILES | CSc1nc(-c2ccc(-c3ccc(C(=O)O)cc3F)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C19H12FN3O3S/c1-27-19-22-16(14(9-21)17(24)23-19)11-4-2-10(3-5-11)13-7-6-12(18(25)26)8-15(13)20/h2-8H,1H3,(H,25,26)(H,22,23,24) |
| InChIKey | VIVMALFXXVFNDT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|