C22H19F2N3OS — CID 135907775
4-(4-tert-butylphenyl)-2-[(2,3-difluorophenyl)methylsulfanyl]-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 135907775) has the molecular formula C22H19F2N3OS and a molecular weight of 411.48 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-2-[(2,3-difluorophenyl)methylsulfanyl]-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(4-tert-butylphenyl)-2-[(2,3-difluorophenyl)methylsulfanyl]-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 135907775 |
| Molecular Formula | C22H19F2N3OS |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 4-(4-tert-butylphenyl)-2-[(2,3-difluorophenyl)methylsulfanyl]-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CC(C)(C)c1ccc(-c2nc(SCc3cccc(F)c3F)[nH]c(=O)c2C#N)cc1 |
| InChI | InChI=1S/C22H19F2N3OS/c1-22(2,3)15-9-7-13(8-10-15)19-16(11-25)20(28)27-21(26-19)29-12-14-5-4-6-17(23)18(14)24/h4-10H,12H2,1-3H3,(H,26,27,28) |
| InChIKey | DNVRUCPBSYXXSI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|