C17H14ClF3N4O2S — CID 135996156
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanamide (PubChem CID 135996156) has the molecular formula C17H14ClF3N4O2S and a molecular weight of 430.84 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 135996156 |
| Molecular Formula | C17H14ClF3N4O2S |
| Molecular Weight | 430.84 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanamide |
| SMILES | CCc1nc(SC(C)C(=O)Nc2cc(C(F)(F)F)ccc2Cl)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C17H14ClF3N4O2S/c1-3-12-10(7-22)15(27)25-16(24-12)28-8(2)14(26)23-13-6-9(17(19,20)21)4-5-11(13)18/h4-6,8H,3H2,1-2H3,(H,23,26)(H,24,25,27) |
| InChIKey | HPQNYCPFGVIKHH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.84 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|